C21H27NO3 — CID 164565105
[2-[(E)-4-(dimethylamino)-2-methylpent-3-en-2-yl]-4-hydroxy-3-methylnaphthalen-1-yl] acetate (PubChem CID 164565105) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is [2-[(E)-4-(dimethylamino)-2-methylpent-3-en-2-yl]-4-hydroxy-3-methylnaphthalen-1-yl] acetate.
| Compound Name | [2-[(E)-4-(dimethylamino)-2-methylpent-3-en-2-yl]-4-hydroxy-3-methylnaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 164565105 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [2-[(E)-4-(dimethylamino)-2-methylpent-3-en-2-yl]-4-hydroxy-3-methylnaphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)/C=C(\C)N(C)C)c(C)c(O)c2ccccc12 |
| InChI | InChI=1S/C21H27NO3/c1-13(22(6)7)12-21(4,5)18-14(2)19(24)16-10-8-9-11-17(16)20(18)25-15(3)23/h8-12,24H,1-7H3/b13-12+ |
| InChIKey | LMCCYHLTTCGSBP-OUKQBFOZSA-N |
| XLogP | 4.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|