C20H19F3N2O3 — CID 170608537
5,5-dimethyl-3-[4-[[2-methyl-6-(trifluoromethyl)phenyl]methoxy]phenyl]imidazolidine-2,4-dione (PubChem CID 170608537) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-[[2-methyl-6-(trifluoromethyl)phenyl]methoxy]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[4-[[2-methyl-6-(trifluoromethyl)phenyl]methoxy]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 170608537 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 5,5-dimethyl-3-[4-[[2-methyl-6-(trifluoromethyl)phenyl]methoxy]phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(C(F)(F)F)c1COc1ccc(N2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C20H19F3N2O3/c1-12-5-4-6-16(20(21,22)23)15(12)11-28-14-9-7-13(8-10-14)25-17(26)19(2,3)24-18(25)27/h4-10H,11H2,1-3H3,(H,24,27) |
| InChIKey | SNHPMFHLVMILHL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|