C36H45N5O — CID 170610453
N-[2-(dimethylamino)ethyl]-4-(4-ethanimidoyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-2(11),3,5,7,9-pentaen-10-yl)benzamide;(3E)-N,3,4-trimethylhexa-3,5-dien-2-imine (PubChem CID 170610453) has the molecular formula C36H45N5O and a molecular weight of 563.79 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(4-ethanimidoyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-2(11),3,5,7,9-pentaen-10-yl)benzamide;(3E)-N,3,4-trimethylhexa-3,5-dien-2-imine.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(4-ethanimidoyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-2(11),3,5,7,9-pentaen-10-yl)benzamide;(3E)-N,3,4-trimethylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 170610453 |
| Molecular Formula | C36H45N5O |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(4-ethanimidoyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-2(11),3,5,7,9-pentaen-10-yl)benzamide;(3E)-N,3,4-trimethylhexa-3,5-dien-2-imine |
| SMILES | C=C/C(C)=C(C)/C(C)=N/C.[H]/N=C(\C)c1cccc2nc(-c3ccc(C(=O)NCCN(C)C)cc3)c3c(c12)C1CCC3C1 |
| InChI | InChI=1S/C27H30N4O.C9H15N/c1-16(28)21-5-4-6-22-25(21)23-19-11-12-20(15-19)24(23)26(30-22)17-7-9-18(10-8-17)27(32)29-13-14-31(2)3;1-6-7(2)8(3)9(4)10-5/h4-10,19-20,28H,11-15H2,1-3H3,(H,29,32);6H,1H2,2-5H3/b28-16+;8-7+,10-9+ |
| InChIKey | STONAOOVDZXQJA-MBOSSEBVSA-N |
| XLogP | 7.55 |
| TPSA | 81.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|