C27H28FN5O — CID 177299878
N-[2-(dimethylamino)ethyl]-3-fluoro-4-(5-methyl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-2(14),3(11),4,7,9,12-hexaen-13-yl)benzamide (PubChem CID 177299878) has the molecular formula C27H28FN5O and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-fluoro-4-(5-methyl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-2(14),3(11),4,7,9,12-hexaen-13-yl)benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-fluoro-4-(5-methyl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-2(14),3(11),4,7,9,12-hexaen-13-yl)benzamide |
|---|---|
| PubChem CID | 177299878 |
| Molecular Formula | C27H28FN5O |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-fluoro-4-(5-methyl-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-2(14),3(11),4,7,9,12-hexaen-13-yl)benzamide |
| SMILES | Cc1[nH]nc2ccc3nc(-c4ccc(C(=O)NCCN(C)C)cc4F)c4c(c3c12)C1CCC4C1 |
| InChI | InChI=1S/C27H28FN5O/c1-14-22-21(32-31-14)9-8-20-25(22)23-15-4-5-16(12-15)24(23)26(30-20)18-7-6-17(13-19(18)28)27(34)29-10-11-33(2)3/h6-9,13,15-16H,4-5,10-12H2,1-3H3,(H,29,34)(H,31,32) |
| InChIKey | AAMXKBLJHVQEAL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |