C15H18FO5PS — CID 170614048
[3-(4-fluoro-6-methoxy-5-propan-2-yl-1-benzothiophen-2-yl)-3-oxopropyl]phosphonic acid (PubChem CID 170614048) has the molecular formula C15H18FO5PS and a molecular weight of 360.34 g/mol. Its IUPAC name is [3-(4-fluoro-6-methoxy-5-propan-2-yl-1-benzothiophen-2-yl)-3-oxopropyl]phosphonic acid.
| Compound Name | [3-(4-fluoro-6-methoxy-5-propan-2-yl-1-benzothiophen-2-yl)-3-oxopropyl]phosphonic acid |
|---|---|
| PubChem CID | 170614048 |
| Molecular Formula | C15H18FO5PS |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [3-(4-fluoro-6-methoxy-5-propan-2-yl-1-benzothiophen-2-yl)-3-oxopropyl]phosphonic acid |
| SMILES | COc1cc2sc(C(=O)CCP(=O)(O)O)cc2c(F)c1C(C)C |
| InChI | InChI=1S/C15H18FO5PS/c1-8(2)14-11(21-3)7-12-9(15(14)16)6-13(23-12)10(17)4-5-22(18,19)20/h6-8H,4-5H2,1-3H3,(H2,18,19,20) |
| InChIKey | NILXOYALEIARJG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|