C20H20ClN3O2 — CID 170614580
trans-(1R,3R)-3-[1-[(6-chloro-3-pyridinyl)amino]isoquinolin-6-yl]oxycyclohexan-1-ol (PubChem CID 170614580) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is trans-(1R,3R)-3-[1-[(6-chloro-3-pyridinyl)amino]isoquinolin-6-yl]oxycyclohexan-1-ol.
| Compound Name | trans-(1R,3R)-3-[1-[(6-chloro-3-pyridinyl)amino]isoquinolin-6-yl]oxycyclohexan-1-ol |
|---|---|
| PubChem CID | 170614580 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | trans-(1R,3R)-3-[1-[(6-chloro-3-pyridinyl)amino]isoquinolin-6-yl]oxycyclohexan-1-ol |
| SMILES | O[C@@H]1CCC[C@@H](Oc2ccc3c(Nc4ccc(Cl)nc4)nccc3c2)C1 |
| InChI | InChI=1S/C20H20ClN3O2/c21-19-7-4-14(12-23-19)24-20-18-6-5-17(10-13(18)8-9-22-20)26-16-3-1-2-15(25)11-16/h4-10,12,15-16,25H,1-3,11H2,(H,22,24)/t15-,16-/m1/s1 |
| InChIKey | FCWYVPVEPANBMA-HZPDHXFCSA-N |
| XLogP | 4.71 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|