C17H19FN4OS — CID 170616611
5-(5-tert-butylsulfanyl-6-methoxypyrazolo[1,5-a]pyridin-3-yl)-6-fluoropyridin-2-amine (PubChem CID 170616611) has the molecular formula C17H19FN4OS and a molecular weight of 346.43 g/mol. Its IUPAC name is 5-(5-tert-butylsulfanyl-6-methoxypyrazolo[1,5-a]pyridin-3-yl)-6-fluoropyridin-2-amine.
| Compound Name | 5-(5-tert-butylsulfanyl-6-methoxypyrazolo[1,5-a]pyridin-3-yl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 170616611 |
| Molecular Formula | C17H19FN4OS |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 5-(5-tert-butylsulfanyl-6-methoxypyrazolo[1,5-a]pyridin-3-yl)-6-fluoropyridin-2-amine |
| SMILES | COc1cn2ncc(-c3ccc(N)nc3F)c2cc1SC(C)(C)C |
| InChI | InChI=1S/C17H19FN4OS/c1-17(2,3)24-14-7-12-11(8-20-22(12)9-13(14)23-4)10-5-6-15(19)21-16(10)18/h5-9H,1-4H3,(H2,19,21) |
| InChIKey | YTOWCNPOCJLZGV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|