C28H38F3N5O3 — CID 170631640
(2S)-N-[1-cyano-2-(1H-indol-3-yl)ethyl]-3-(3,3-dimethylbutanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide;methane;2,2,2-trifluoroacetamide (PubChem CID 170631640) has the molecular formula C28H38F3N5O3 and a molecular weight of 549.64 g/mol. Its IUPAC name is (2S)-N-[1-cyano-2-(1H-indol-3-yl)ethyl]-3-(3,3-dimethylbutanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide;methane;2,2,2-trifluoroacetamide.
| Compound Name | (2S)-N-[1-cyano-2-(1H-indol-3-yl)ethyl]-3-(3,3-dimethylbutanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide;methane;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170631640 |
| Molecular Formula | C28H38F3N5O3 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | (2S)-N-[1-cyano-2-(1H-indol-3-yl)ethyl]-3-(3,3-dimethylbutanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide;methane;2,2,2-trifluoroacetamide |
| SMILES | C.CC(C)(C)CC(=O)N1CC2C([C@H]1C(=O)NC(C#N)Cc1c[nH]c3ccccc13)C2(C)C.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H32N4O2.C2H2F3NO.CH4/c1-24(2,3)11-20(30)29-14-18-21(25(18,4)5)22(29)23(31)28-16(12-26)10-15-13-27-19-9-7-6-8-17(15)19;3-2(4,5)1(6)7;/h6-9,13,16,18,21-22,27H,10-11,14H2,1-5H3,(H,28,31);(H2,6,7);1H4/t16?,18?,21?,22-;;/m0../s1 |
| InChIKey | UCGDRSBNFUULEJ-BFGJIVIMSA-N |
| XLogP | 4.31 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |