C28H38N7O2U- — CID 170635476
tert-butyl N-[(3E,5E)-5-[1-[6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]pyrazolo[1,5-a]pyrazin-3-yl]ethenylamino]-6,7-dimethylnona-1,3,5-trien-3-yl]carbamate;uranium (PubChem CID 170635476) has the molecular formula C28H38N7O2U- and a molecular weight of 742.69 g/mol. Its IUPAC name is tert-butyl N-[(3E,5E)-5-[1-[6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]pyrazolo[1,5-a]pyrazin-3-yl]ethenylamino]-6,7-dimethylnona-1,3,5-trien-3-yl]carbamate;uranium.
| Compound Name | tert-butyl N-[(3E,5E)-5-[1-[6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]pyrazolo[1,5-a]pyrazin-3-yl]ethenylamino]-6,7-dimethylnona-1,3,5-trien-3-yl]carbamate;uranium |
|---|---|
| PubChem CID | 170635476 |
| Molecular Formula | C28H38N7O2U- |
| Molecular Weight | 742.69 g/mol |
| Exact Mass | 742.36 |
| IUPAC Name | tert-butyl N-[(3E,5E)-5-[1-[6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]pyrazolo[1,5-a]pyrazin-3-yl]ethenylamino]-6,7-dimethylnona-1,3,5-trien-3-yl]carbamate;uranium |
| SMILES | [H]/[C-]=C(\NC(/C=C(\C=C)NC(=O)OC(C)(C)C)=C(\C)C(C)CC)c1cnn2cc(C(=C/N)/C=N/C)ncc12.[U] |
| InChI | InChI=1S/C28H38N7O2.U/c1-10-18(3)19(4)24(12-22(11-2)34-27(36)37-28(6,7)8)33-20(5)23-15-32-35-17-25(31-16-26(23)35)21(13-29)14-30-9;/h5,11-18,33H,2,10,29H2,1,3-4,6-9H3,(H,34,36);/q-1;/b21-13+,22-12+,24-19+,30-14+; |
| InChIKey | JPZVCYTWGDWHLX-GHFXHFKTSA-N |
| XLogP | 5.01 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|