C35H69NO2 — CID 170645822
(10Z,13Z)-1-[3-butylnonyl(3-hydroxypropyl)amino]nonadeca-10,13-dien-2-ol (PubChem CID 170645822) has the molecular formula C35H69NO2 and a molecular weight of 535.94 g/mol. Its IUPAC name is (10Z,13Z)-1-[3-butylnonyl(3-hydroxypropyl)amino]nonadeca-10,13-dien-2-ol.
| Compound Name | (10Z,13Z)-1-[3-butylnonyl(3-hydroxypropyl)amino]nonadeca-10,13-dien-2-ol |
|---|---|
| PubChem CID | 170645822 |
| Molecular Formula | C35H69NO2 |
| Molecular Weight | 535.94 g/mol |
| Exact Mass | 535.53 |
| IUPAC Name | (10Z,13Z)-1-[3-butylnonyl(3-hydroxypropyl)amino]nonadeca-10,13-dien-2-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(O)CN(CCCO)CCC(CCCC)CCCCCC |
| InChI | InChI=1S/C35H69NO2/c1-4-7-10-12-13-14-15-16-17-18-19-20-21-22-24-28-35(38)33-36(30-25-32-37)31-29-34(26-9-6-3)27-23-11-8-5-2/h13-14,16-17,34-35,37-38H,4-12,15,18-33H2,1-3H3/b14-13-,17-16- |
| InChIKey | QSOIRAPMRGDEKA-AUGURXLVSA-N |
| XLogP | 10.01 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.94 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|