C18H13BrF3N3 — CID 170655496
2-[2-(6-bromo-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzonitrile (PubChem CID 170655496) has the molecular formula C18H13BrF3N3 and a molecular weight of 408.22 g/mol. Its IUPAC name is 2-[2-(6-bromo-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[2-(6-bromo-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 170655496 |
| Molecular Formula | C18H13BrF3N3 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 2-[2-(6-bromo-1H-indol-3-yl)ethylamino]-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1NCCc1c[nH]c2cc(Br)ccc12 |
| InChI | InChI=1S/C18H13BrF3N3/c19-14-2-3-15-11(10-25-17(15)8-14)5-6-24-16-4-1-13(18(20,21)22)7-12(16)9-23/h1-4,7-8,10,24-25H,5-6H2 |
| InChIKey | HGAZJQRCSPINKA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |