C10H10ClF3O4 — CID 170661187
ethyl (Z)-2-(2-chloroacetyl)-6,6,6-trifluoro-5-oxohex-3-enoate (PubChem CID 170661187) has the molecular formula C10H10ClF3O4 and a molecular weight of 286.63 g/mol. Its IUPAC name is ethyl (Z)-2-(2-chloroacetyl)-6,6,6-trifluoro-5-oxohex-3-enoate.
| Compound Name | ethyl (Z)-2-(2-chloroacetyl)-6,6,6-trifluoro-5-oxohex-3-enoate |
|---|---|
| PubChem CID | 170661187 |
| Molecular Formula | C10H10ClF3O4 |
| Molecular Weight | 286.63 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | ethyl (Z)-2-(2-chloroacetyl)-6,6,6-trifluoro-5-oxohex-3-enoate |
| SMILES | CCOC(=O)C(/C=C\C(=O)C(F)(F)F)C(=O)CCl |
| InChI | InChI=1S/C10H10ClF3O4/c1-2-18-9(17)6(7(15)5-11)3-4-8(16)10(12,13)14/h3-4,6H,2,5H2,1H3/b4-3- |
| InChIKey | UBAMOZYCSRVRKN-ARJAWSKDSA-N |
| XLogP | 1.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|