C91H78N5Pt-3 — CID 170668620
CID 170668620 (PubChem CID 170668620) has the molecular formula C91H78N5Pt-3 and a molecular weight of 1444.79 g/mol.
| Compound Name | CID 170668620 |
|---|---|
| PubChem CID | 170668620 |
| Molecular Formula | C91H78N5Pt-3 |
| Molecular Weight | 1444.79 g/mol |
| Exact Mass | 1443.64 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2N2[CH-]N(c3[c-]c(N(c4[c-]c5c(cc4)-c4ccccc4-c4ccccc4N5c4cc(C([2H])([2H])[2H])c(-c5ccccc5)cn4)c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc(C(C)(C)C)c3)c3ccccc32)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C91H78N5.Pt/c1-61-48-87(92-59-82(61)65-36-21-14-22-37-65)96-83-43-26-25-40-80(83)78-38-23-24-39-79(78)81-47-46-72(58-86(81)96)95(74-52-66(62-30-15-11-16-31-62)49-67(53-74)63-32-17-12-18-33-63)75-56-71(91(8,9)10)55-73(57-75)93-60-94(85-45-28-27-44-84(85)93)88-76(64-34-19-13-20-35-64)41-29-42-77(88)68-50-69(89(2,3)4)54-70(51-68)90(5,6)7;/h11-56,59-60H,1-10H3;/q-3;/i1D3,13D,19D,20D,34D,35D; |
| InChIKey | WWYRFDLRPJTZJA-PPQDRILESA-N |
| XLogP | 25.21 |
| TPSA | 25.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 97 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1444.79 |
| LogP ≤ 5 | 25.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|