C60H50N7Pt-3 — CID 170668573
CID 170668573 (PubChem CID 170668573) has the molecular formula C60H50N7Pt-3 and a molecular weight of 1064.19 g/mol.
| Compound Name | CID 170668573 |
|---|---|
| PubChem CID | 170668573 |
| Molecular Formula | C60H50N7Pt-3 |
| Molecular Weight | 1064.19 g/mol |
| Exact Mass | 1063.38 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(N2[CH-]N(c3cccc(C(C)(C)C)c3)c3nccnc32)[c-]c(N(c2[c-]c3c(cc2)-c2ccccc2-c2ccc(-c4ccccc4)cc2N3c2ccccn2)c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C60H50N7.Pt/c1-59(2,3)43-20-17-23-46(35-43)64-40-65(58-57(64)62-32-33-63-58)48-36-44(60(4,5)6)37-49(38-48)66(45-21-11-8-12-22-45)47-28-30-53-51-25-14-13-24-50(51)52-29-27-42(41-18-9-7-10-19-41)34-54(52)67(55(53)39-47)56-26-15-16-31-61-56;/h7-37,40H,1-6H3;/q-3; |
| InChIKey | MKYYFCWCPFBZJP-UHFFFAOYSA-N |
| XLogP | 15.73 |
| TPSA | 51.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1064.19 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|