About CID 176782986
CID 176782986 (PubChem CID 176782986) has the molecular formula C80H61N10OPt-3
and a molecular weight of 1373.51 g/mol.
Molecular Properties
| Compound Name | CID 176782986 |
| PubChem CID | 176782986 |
| Molecular Formula | C80H61N10OPt-3 |
| Molecular Weight | 1373.51 g/mol |
| Exact Mass | 1372.47 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(N2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6c(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)cc(C(C)(C)C)cc6-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c6ccccc65)ccc4)ccc3-c3ccccc3-c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C80H61N10O.Pt/c1-79(2,3)56-44-45-81-71(48-56)90-67-39-22-21-38-63(67)61-36-19-20-37-62(61)64-43-42-60(50-70(64)90)91-59-35-25-34-58(49-59)88-51-89(69-41-24-23-40-68(69)88)72-65(77-84-73(52-26-11-7-12-27-52)82-74(85-77)53-28-13-8-14-29-53)46-57(80(4,5)6)47-66(72)78-86-75(54-30-15-9-16-31-54)83-76(87-78)55-32-17-10-18-33-55;/h7-48,51H,1-6H3;/q-3; |
| InChIKey | QCKCLPLLJJHJIB-UHFFFAOYSA-N |
| XLogP | 19.97 |
| TPSA | 109.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 92 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1373.51 |
| LogP ≤ 5 | 19.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 176782986 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176782986?
The IUPAC name of CID 176782986 (CID 176782986) is not available.
What is the SMILES notation for CID 176782986?
The canonical SMILES for CID 176782986 is CC(C)(C)c1ccnc(N2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6c(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)cc(C(C)(C)C)cc6-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c6ccccc65)ccc4)ccc3-c3ccccc3-c3ccccc32)c1.[Pt].
What is the InChIKey of CID 176782986?
The InChIKey is QCKCLPLLJJHJIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C80H61N10O.Pt/c1-79(2,3)56-44-45-81-71(48-56)90-67-39-22-21-38-63(67)61-36-19-20-37-62(61)64-43-42-60(50-70(64)90)91-59-35-25-34-58(49-59)88-51-89(69-41-24-23-40-68(69)88)72-65(77-84-73(52-26-11-7-12-27-52)82-74(85-77)53-28-13-8-14-29-53)46-57(80(4,5)6)47-66(72)78-86-75(54-30-15-9-16-31-54)83-76(87-78)55-32-17-10-18-33-55;/h7-48,51H,1-6H3;/q-3;.
What are the key properties of CID 176782986?
CID 176782986 has a molecular weight of 1373.51 g/mol, XLogP of 19.97, 11 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176782986 is sourced from PubChem (CID 176782986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).