C55H53N4OPt-3 — CID 176783679
CID 176783679 (PubChem CID 176783679) has the molecular formula C55H53N4OPt-3 and a molecular weight of 981.13 g/mol.
| Compound Name | CID 176783679 |
|---|---|
| PubChem CID | 176783679 |
| Molecular Formula | C55H53N4OPt-3 |
| Molecular Weight | 981.13 g/mol |
| Exact Mass | 980.39 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(C)(C)C)c(N2[CH-]N(c3[c-]c(Oc4[c-]c5c(cc4)-c4ccccc4-c4ccccc4N5c4cc(C(C)(C)C)ccn4)ccc3)c3ccccc32)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C55H53N4O.Pt/c1-36-30-45(54(5,6)7)52(46(31-36)55(8,9)10)58-35-57(48-24-15-16-25-49(48)58)38-18-17-19-39(33-38)60-40-26-27-44-42-21-12-11-20-41(42)43-22-13-14-23-47(43)59(50(44)34-40)51-32-37(28-29-56-51)53(2,3)4;/h11-32,35H,1-10H3;/q-3; |
| InChIKey | SLBROOALWXDTSC-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.13 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|