C48H43N4OPt-3 — CID 176783257
CID 176783257 (PubChem CID 176783257) has the molecular formula C48H43N4OPt-3 and a molecular weight of 886.98 g/mol.
| Compound Name | CID 176783257 |
|---|---|
| PubChem CID | 176783257 |
| Molecular Formula | C48H43N4OPt-3 |
| Molecular Weight | 886.98 g/mol |
| Exact Mass | 886.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(N2c3[c-]c(Oc4[c-]c(N5[CH-]N(C67CCC(CC6)CC7)c6ccccc65)ccc4)ccc3-c3ccccc3-c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C48H43N4O.Pt/c1-47(2,3)34-24-28-49-46(29-34)52-42-16-7-6-15-40(42)38-13-4-5-14-39(38)41-20-19-37(31-45(41)52)53-36-12-10-11-35(30-36)50-32-51(44-18-9-8-17-43(44)50)48-25-21-33(22-26-48)23-27-48;/h4-20,24,28-29,32-33H,21-23,25-27H2,1-3H3;/q-3; |
| InChIKey | DIVOYOIVUKGZOV-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.98 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|