C49H41N4OPt-3 — CID 176783451
CID 176783451 (PubChem CID 176783451) has the molecular formula C49H41N4OPt-3 and a molecular weight of 896.97 g/mol.
| Compound Name | CID 176783451 |
|---|---|
| PubChem CID | 176783451 |
| Molecular Formula | C49H41N4OPt-3 |
| Molecular Weight | 896.97 g/mol |
| Exact Mass | 896.29 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(N2[CH-]N(c3[c-]c(Oc4[c-]c5c(cc4)-c4ccccc4-c4ccccc4N5c4cc(C(C)(C)C)ccn4)ccc3)c3ccccc32)c(C)c1.[Pt] |
| InChI | InChI=1S/C49H41N4O.Pt/c1-32-26-33(2)48(34(3)27-32)52-31-51(44-20-11-12-21-45(44)52)36-14-13-15-37(29-36)54-38-22-23-42-40-17-8-7-16-39(40)41-18-9-10-19-43(41)53(46(42)30-38)47-28-35(24-25-50-47)49(4,5)6;/h7-28,31H,1-6H3;/q-3; |
| InChIKey | QKBQXHXAINXKFW-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.97 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|