C45H39N4OPt-3 — CID 176781934
CID 176781934 (PubChem CID 176781934) has the molecular formula C45H39N4OPt-3 and a molecular weight of 846.91 g/mol.
| Compound Name | CID 176781934 |
|---|---|
| PubChem CID | 176781934 |
| Molecular Formula | C45H39N4OPt-3 |
| Molecular Weight | 846.91 g/mol |
| Exact Mass | 846.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(N2c3[c-]c(Oc4[c-]c(N5[CH-]N(C6CCCC6)c6ccccc65)ccc4)ccc3-c3ccccc3-c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C45H39N4O.Pt/c1-45(2,3)31-25-26-46-44(27-31)49-40-20-9-8-19-38(40)36-17-6-7-18-37(36)39-24-23-35(29-43(39)49)50-34-16-12-15-33(28-34)48-30-47(32-13-4-5-14-32)41-21-10-11-22-42(41)48;/h6-12,15-27,30,32H,4-5,13-14H2,1-3H3;/q-3; |
| InChIKey | ASYWKTWBRLDCRO-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.91 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|