C72H64N5Pt-3 — CID 170668675
CID 170668675 (PubChem CID 170668675) has the molecular formula C72H64N5Pt-3 and a molecular weight of 1194.42 g/mol.
| Compound Name | CID 170668675 |
|---|---|
| PubChem CID | 170668675 |
| Molecular Formula | C72H64N5Pt-3 |
| Molecular Weight | 1194.42 g/mol |
| Exact Mass | 1193.48 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2ccnc(N3c4[c-]c(N(c5[c-]c(N6[CH-]N(c7cc(C(C)(C)C)cc(C(C)(C)C)c7)c7ccccc76)cc(-c6ccccc6)c5)c5ccccc5)ccc4-c4ccccc4-c4ccccc43)c2)cc1.[Pt] |
| InChI | InChI=1S/C72H64N5.Pt/c1-70(2,3)53-34-32-50(33-35-53)51-38-39-73-69(42-51)77-65-29-19-18-28-63(65)61-26-16-17-27-62(61)64-37-36-57(47-68(64)77)76(56-24-14-11-15-25-56)60-41-52(49-22-12-10-13-23-49)40-58(46-60)74-48-75(67-31-21-20-30-66(67)74)59-44-54(71(4,5)6)43-55(45-59)72(7,8)9;/h10-45,48H,1-9H3;/q-3; |
| InChIKey | FNLJUDQWJUTUST-UHFFFAOYSA-N |
| XLogP | 19.90 |
| TPSA | 25.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1194.42 |
| LogP ≤ 5 | 19.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|