About CID 170668738
CID 170668738 (PubChem CID 170668738) has the molecular formula C52H40N5Pt-3
and a molecular weight of 930.01 g/mol.
Molecular Properties
| Compound Name | CID 170668738 |
| PubChem CID | 170668738 |
| Molecular Formula | C52H40N5Pt-3 |
| Molecular Weight | 930.01 g/mol |
| Exact Mass | 929.29 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(N2[CH-]N(c3ccccc3)c3ccccc32)[c-]c(N(c2[c-]c3c(cc2)-c2ccccc2-c2ccccc2N3c2ccccn2)c2ccccc2)c1.[Pt] |
| InChI | InChI=1S/C52H40N5.Pt/c1-52(2,3)37-32-41(55-36-54(38-18-6-4-7-19-38)48-26-14-15-27-49(48)55)34-42(33-37)56(39-20-8-5-9-21-39)40-29-30-46-44-23-11-10-22-43(44)45-24-12-13-25-47(45)57(50(46)35-40)51-28-16-17-31-53-51;/h4-33,36H,1-3H3;/q-3; |
| InChIKey | QBDUHHKXSJXYFI-UHFFFAOYSA-N |
| XLogP | 13.97 |
| TPSA | 25.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 930.01 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 170668738 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170668738?
The IUPAC name of CID 170668738 (CID 170668738) is not available.
What is the SMILES notation for CID 170668738?
The canonical SMILES for CID 170668738 is CC(C)(C)c1cc(N2[CH-]N(c3ccccc3)c3ccccc32)[c-]c(N(c2[c-]c3c(cc2)-c2ccccc2-c2ccccc2N3c2ccccn2)c2ccccc2)c1.[Pt].
What is the InChIKey of CID 170668738?
The InChIKey is QBDUHHKXSJXYFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H40N5.Pt/c1-52(2,3)37-32-41(55-36-54(38-18-6-4-7-19-38)48-26-14-15-27-49(48)55)34-42(33-37)56(39-20-8-5-9-21-39)40-29-30-46-44-23-11-10-22-43(44)45-24-12-13-25-47(45)57(50(46)35-40)51-28-16-17-31-53-51;/h4-33,36H,1-3H3;/q-3;.
What are the key properties of CID 170668738?
CID 170668738 has a molecular weight of 930.01 g/mol, XLogP of 13.97, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170668738 is sourced from PubChem (CID 170668738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).