About CID 170668843
CID 170668843 (PubChem CID 170668843) has the molecular formula C54H36N5Pt-3
and a molecular weight of 950.00 g/mol.
Molecular Properties
| Compound Name | CID 170668843 |
| PubChem CID | 170668843 |
| Molecular Formula | C54H36N5Pt-3 |
| Molecular Weight | 950.00 g/mol |
| Exact Mass | 949.26 |
| IUPAC Name | — |
| SMILES | [Pt].[c-]1c(N2[CH-]N(c3ccccc3)c3ccccc32)cc(-c2ccccc2)cc1N(c1[c-]c2c(cc1)-c1ccccc1-c1ccccc1N2c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C54H36N5.Pt/c1-4-18-39(19-5-1)40-34-44(57-38-56(41-20-6-2-7-21-41)51-28-14-15-29-52(51)57)36-45(35-40)58(42-22-8-3-9-23-42)43-31-32-49-47-25-11-10-24-46(47)48-26-12-13-27-50(48)59(53(49)37-43)54-30-16-17-33-55-54;/h1-35,38H;/q-3; |
| InChIKey | JKRGWZWDCBZFTG-UHFFFAOYSA-N |
| XLogP | 14.34 |
| TPSA | 25.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 950.00 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 170668843 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170668843?
The IUPAC name of CID 170668843 (CID 170668843) is not available.
What is the SMILES notation for CID 170668843?
The canonical SMILES for CID 170668843 is [Pt].[c-]1c(N2[CH-]N(c3ccccc3)c3ccccc32)cc(-c2ccccc2)cc1N(c1[c-]c2c(cc1)-c1ccccc1-c1ccccc1N2c1ccccn1)c1ccccc1.
What is the InChIKey of CID 170668843?
The InChIKey is JKRGWZWDCBZFTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H36N5.Pt/c1-4-18-39(19-5-1)40-34-44(57-38-56(41-20-6-2-7-21-41)51-28-14-15-29-52(51)57)36-45(35-40)58(42-22-8-3-9-23-42)43-31-32-49-47-25-11-10-24-46(47)48-26-12-13-27-50(48)59(53(49)37-43)54-30-16-17-33-55-54;/h1-35,38H;/q-3;.
What are the key properties of CID 170668843?
CID 170668843 has a molecular weight of 950.00 g/mol, XLogP of 14.34, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170668843 is sourced from PubChem (CID 170668843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).