C37H45NS — CID 170678545
2-[1-(4-tert-butylnaphthalen-2-yl)isoquinolin-5-yl]-5,5,8,8-tetramethyl-1,2,3,4,4a,6,7,8a-octahydronaphthalene-1-thiol (PubChem CID 170678545) has the molecular formula C37H45NS and a molecular weight of 535.84 g/mol. Its IUPAC name is 2-[1-(4-tert-butylnaphthalen-2-yl)isoquinolin-5-yl]-5,5,8,8-tetramethyl-1,2,3,4,4a,6,7,8a-octahydronaphthalene-1-thiol.
| Compound Name | 2-[1-(4-tert-butylnaphthalen-2-yl)isoquinolin-5-yl]-5,5,8,8-tetramethyl-1,2,3,4,4a,6,7,8a-octahydronaphthalene-1-thiol |
|---|---|
| PubChem CID | 170678545 |
| Molecular Formula | C37H45NS |
| Molecular Weight | 535.84 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 2-[1-(4-tert-butylnaphthalen-2-yl)isoquinolin-5-yl]-5,5,8,8-tetramethyl-1,2,3,4,4a,6,7,8a-octahydronaphthalene-1-thiol |
| SMILES | CC(C)(C)c1cc(-c2nccc3c(C4CCC5C(C4S)C(C)(C)CCC5(C)C)cccc23)cc2ccccc12 |
| InChI | InChI=1S/C37H45NS/c1-35(2,3)31-22-24(21-23-11-8-9-12-25(23)31)33-28-14-10-13-26(27(28)17-20-38-33)29-15-16-30-32(34(29)39)37(6,7)19-18-36(30,4)5/h8-14,17,20-22,29-30,32,34,39H,15-16,18-19H2,1-7H3 |
| InChIKey | DBFOLFIJAMJSBS-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.84 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|