C37H32N4O — CID 170685780
2-[1-[2,6-di(propan-2-yl)phenyl]-4-quinolin-8-ylimidazol-2-yl]phenanthridin-10-ol (PubChem CID 170685780) has the molecular formula C37H32N4O and a molecular weight of 548.69 g/mol. Its IUPAC name is 2-[1-[2,6-di(propan-2-yl)phenyl]-4-quinolin-8-ylimidazol-2-yl]phenanthridin-10-ol.
| Compound Name | 2-[1-[2,6-di(propan-2-yl)phenyl]-4-quinolin-8-ylimidazol-2-yl]phenanthridin-10-ol |
|---|---|
| PubChem CID | 170685780 |
| Molecular Formula | C37H32N4O |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 2-[1-[2,6-di(propan-2-yl)phenyl]-4-quinolin-8-ylimidazol-2-yl]phenanthridin-10-ol |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc(-c2cccc3cccnc23)nc1-c1ccc2ncc3cccc(O)c3c2c1 |
| InChI | InChI=1S/C37H32N4O/c1-22(2)27-12-7-13-28(23(3)4)36(27)41-21-32(29-14-5-9-24-11-8-18-38-35(24)29)40-37(41)25-16-17-31-30(19-25)34-26(20-39-31)10-6-15-33(34)42/h5-23,42H,1-4H3 |
| InChIKey | FKIORIKKIBAMOY-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|