C43H27N4OPt- — CID 170685809
2-[1-(2,6-diphenylphenyl)-4-quinolin-8-ylimidazol-2-yl]-1H-phenanthridin-1-id-10-ol;platinum (PubChem CID 170685809) has the molecular formula C43H27N4OPt- and a molecular weight of 810.79 g/mol. Its IUPAC name is 2-[1-(2,6-diphenylphenyl)-4-quinolin-8-ylimidazol-2-yl]-1H-phenanthridin-1-id-10-ol;platinum.
| Compound Name | 2-[1-(2,6-diphenylphenyl)-4-quinolin-8-ylimidazol-2-yl]-1H-phenanthridin-1-id-10-ol;platinum |
|---|---|
| PubChem CID | 170685809 |
| Molecular Formula | C43H27N4OPt- |
| Molecular Weight | 810.79 g/mol |
| Exact Mass | 810.18 |
| IUPAC Name | 2-[1-(2,6-diphenylphenyl)-4-quinolin-8-ylimidazol-2-yl]-1H-phenanthridin-1-id-10-ol;platinum |
| SMILES | Oc1cccc2cnc3ccc(-c4nc(-c5cccc6cccnc56)cn4-c4c(-c5ccccc5)cccc4-c4ccccc4)[c-]c3c12.[Pt] |
| InChI | InChI=1S/C43H27N4O.Pt/c48-39-21-8-16-32-26-45-37-23-22-31(25-36(37)40(32)39)43-46-38(35-20-7-15-30-17-10-24-44-41(30)35)27-47(43)42-33(28-11-3-1-4-12-28)18-9-19-34(42)29-13-5-2-6-14-29;/h1-24,26-27,48H;/q-1; |
| InChIKey | QPQWIVDWLIPWNG-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.79 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|