C36H48O8 — CID 170690730
dimethyl (1R,2S,3R,4S)-3,4-bis[4-[4-(2-methylpropanoyloxy)butyl]phenyl]cyclobutane-1,2-dicarboxylate (PubChem CID 170690730) has the molecular formula C36H48O8 and a molecular weight of 608.77 g/mol. Its IUPAC name is dimethyl (1R,2S,3R,4S)-3,4-bis[4-[4-(2-methylpropanoyloxy)butyl]phenyl]cyclobutane-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3R,4S)-3,4-bis[4-[4-(2-methylpropanoyloxy)butyl]phenyl]cyclobutane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 170690730 |
| Molecular Formula | C36H48O8 |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | dimethyl (1R,2S,3R,4S)-3,4-bis[4-[4-(2-methylpropanoyloxy)butyl]phenyl]cyclobutane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@@H](c2ccc(CCCCOC(=O)C(C)C)cc2)[C@H]1c1ccc(CCCCOC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C36H48O8/c1-23(2)33(37)43-21-9-7-11-25-13-17-27(18-14-25)29-30(32(36(40)42-6)31(29)35(39)41-5)28-19-15-26(16-20-28)12-8-10-22-44-34(38)24(3)4/h13-20,23-24,29-32H,7-12,21-22H2,1-6H3/t29-,30+,31+,32- |
| InChIKey | REHOSXAFNUELEY-UTRLAFKGSA-N |
| XLogP | 6.19 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|