C30H35ClO8 — CID 54128673
diethyl (4R,5R)-2-[4-[4-[6-(2-chloroprop-2-enoyloxy)hexyl]phenyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 54128673) has the molecular formula C30H35ClO8 and a molecular weight of 559.06 g/mol. Its IUPAC name is diethyl (4R,5R)-2-[4-[4-[6-(2-chloroprop-2-enoyloxy)hexyl]phenyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5R)-2-[4-[4-[6-(2-chloroprop-2-enoyloxy)hexyl]phenyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 54128673 |
| Molecular Formula | C30H35ClO8 |
| Molecular Weight | 559.06 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | diethyl (4R,5R)-2-[4-[4-[6-(2-chloroprop-2-enoyloxy)hexyl]phenyl]phenyl]-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | C=C(Cl)C(=O)OCCCCCCc1ccc(-c2ccc(C3O[C@@H](C(=O)OCC)[C@H](C(=O)OCC)O3)cc2)cc1 |
| InChI | InChI=1S/C30H35ClO8/c1-4-35-28(33)25-26(29(34)36-5-2)39-30(38-25)24-17-15-23(16-18-24)22-13-11-21(12-14-22)10-8-6-7-9-19-37-27(32)20(3)31/h11-18,25-26,30H,3-10,19H2,1-2H3/t25-,26-/m1/s1 |
| InChIKey | NSTJVKKSRBLDDK-CLJLJLNGSA-N |
| XLogP | 5.66 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.06 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|