C24H26N2O8 — CID 23295486
2-[4-[5-(6-prop-2-enoyloxyhexyl)pyrimidin-2-yl]phenyl]-1,3-dioxolane-4,5-dicarboxylic acid (PubChem CID 23295486) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is 2-[4-[5-(6-prop-2-enoyloxyhexyl)pyrimidin-2-yl]phenyl]-1,3-dioxolane-4,5-dicarboxylic acid.
| Compound Name | 2-[4-[5-(6-prop-2-enoyloxyhexyl)pyrimidin-2-yl]phenyl]-1,3-dioxolane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 23295486 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-[4-[5-(6-prop-2-enoyloxyhexyl)pyrimidin-2-yl]phenyl]-1,3-dioxolane-4,5-dicarboxylic acid |
| SMILES | C=CC(=O)OCCCCCCc1cnc(-c2ccc(C3OC(C(=O)O)C(C(=O)O)O3)cc2)nc1 |
| InChI | InChI=1S/C24H26N2O8/c1-2-18(27)32-12-6-4-3-5-7-15-13-25-21(26-14-15)16-8-10-17(11-9-16)24-33-19(22(28)29)20(34-24)23(30)31/h2,8-11,13-14,19-20,24H,1,3-7,12H2,(H,28,29)(H,30,31) |
| InChIKey | OSPQDSACMSACAW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 145.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|