C16H17N3O3S — CID 170698536
7,11,14-trioxa-23-thia-4,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2,4,15(22),16,18(21)-hexaene (PubChem CID 170698536) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 7,11,14-trioxa-23-thia-4,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2,4,15(22),16,18(21)-hexaene.
| Compound Name | 7,11,14-trioxa-23-thia-4,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2,4,15(22),16,18(21)-hexaene |
|---|---|
| PubChem CID | 170698536 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 7,11,14-trioxa-23-thia-4,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2,4,15(22),16,18(21)-hexaene |
| SMILES | c1cc2[nH]nc3c2cc1OCCOCCCOCc1ncc-3s1 |
| InChI | InChI=1S/C16H17N3O3S/c1-4-20-6-7-22-11-2-3-13-12(8-11)16(19-18-13)14-9-17-15(23-14)10-21-5-1/h2-3,8-9H,1,4-7,10H2,(H,18,19) |
| InChIKey | KGCYAQZEYSLPPF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |