C17H16BrF3N2O3 — CID 170701335
6-bromo-N-[(2R)-4-hydroxybutan-2-yl]-5-[4-(trifluoromethyl)phenoxy]pyridine-2-carboxamide (PubChem CID 170701335) has the molecular formula C17H16BrF3N2O3 and a molecular weight of 433.22 g/mol. Its IUPAC name is 6-bromo-N-[(2R)-4-hydroxybutan-2-yl]-5-[4-(trifluoromethyl)phenoxy]pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[(2R)-4-hydroxybutan-2-yl]-5-[4-(trifluoromethyl)phenoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170701335 |
| Molecular Formula | C17H16BrF3N2O3 |
| Molecular Weight | 433.22 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 6-bromo-N-[(2R)-4-hydroxybutan-2-yl]-5-[4-(trifluoromethyl)phenoxy]pyridine-2-carboxamide |
| SMILES | C[C@H](CCO)NC(=O)c1ccc(Oc2ccc(C(F)(F)F)cc2)c(Br)n1 |
| InChI | InChI=1S/C17H16BrF3N2O3/c1-10(8-9-24)22-16(25)13-6-7-14(15(18)23-13)26-12-4-2-11(3-5-12)17(19,20)21/h2-7,10,24H,8-9H2,1H3,(H,22,25)/t10-/m1/s1 |
| InChIKey | HDBWHQCUYFBDDC-SNVBAGLBSA-N |
| XLogP | 4.16 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|