About (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide
(2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide (PubChem CID 170718511) has the molecular formula C11H13BrF3N
and a molecular weight of 296.13 g/mol. Its IUPAC name is (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide.
Molecular Properties
| Compound Name | (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide |
| PubChem CID | 170718511 |
| Molecular Formula | C11H13BrF3N |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide |
| SMILES | Br.FC(F)(F)[C@H]1CN[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C11H12F3N.BrH/c12-11(13,14)9-6-10(15-7-9)8-4-2-1-3-5-8;/h1-5,9-10,15H,6-7H2;1H/t9-,10-;/m1./s1 |
| InChIKey | HMPKIHKOHBZJAR-DHTOPLTISA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide?
The IUPAC name of (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide (CID 170718511) is (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide.
What is the SMILES notation for (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide?
The canonical SMILES for (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide is Br.FC(F)(F)[C@H]1CN[C@@H](c2ccccc2)C1.
What is the InChIKey of (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide?
The InChIKey is HMPKIHKOHBZJAR-DHTOPLTISA-N. The full InChI is InChI=1S/C11H12F3N.BrH/c12-11(13,14)9-6-10(15-7-9)8-4-2-1-3-5-8;/h1-5,9-10,15H,6-7H2;1H/t9-,10-;/m1./s1.
What are the key properties of (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide?
(2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide has a molecular weight of 296.13 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-phenyl-4-(trifluoromethyl)pyrrolidine;hydrobromide is sourced from PubChem (CID 170718511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).