C23H30FN5O2 — CID 170720556
2-(4-cyclopropylpiperazin-1-yl)-N-(3-fluoro-4-piperidin-1-ylphenyl)-5-methyl-1,3-oxazole-4-carboxamide (PubChem CID 170720556) has the molecular formula C23H30FN5O2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-(4-cyclopropylpiperazin-1-yl)-N-(3-fluoro-4-piperidin-1-ylphenyl)-5-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(4-cyclopropylpiperazin-1-yl)-N-(3-fluoro-4-piperidin-1-ylphenyl)-5-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 170720556 |
| Molecular Formula | C23H30FN5O2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 2-(4-cyclopropylpiperazin-1-yl)-N-(3-fluoro-4-piperidin-1-ylphenyl)-5-methyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1oc(N2CCN(C3CC3)CC2)nc1C(=O)Nc1ccc(N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C23H30FN5O2/c1-16-21(26-23(31-16)29-13-11-27(12-14-29)18-6-7-18)22(30)25-17-5-8-20(19(24)15-17)28-9-3-2-4-10-28/h5,8,15,18H,2-4,6-7,9-14H2,1H3,(H,25,30) |
| InChIKey | AZSTWGOKRGPZEY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|