C15H29N5O4 — CID 170721461
6-amino-2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]-N-(2-oxobutyl)hexanamide (PubChem CID 170721461) has the molecular formula C15H29N5O4 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]-N-(2-oxobutyl)hexanamide.
| Compound Name | 6-amino-2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]-N-(2-oxobutyl)hexanamide |
|---|---|
| PubChem CID | 170721461 |
| Molecular Formula | C15H29N5O4 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 6-amino-2-[[2-[[2-(methylamino)acetyl]amino]acetyl]amino]-N-(2-oxobutyl)hexanamide |
| SMILES | CCC(=O)CNC(=O)C(CCCCN)NC(=O)CNC(=O)CNC |
| InChI | InChI=1S/C15H29N5O4/c1-3-11(21)8-19-15(24)12(6-4-5-7-16)20-14(23)10-18-13(22)9-17-2/h12,17H,3-10,16H2,1-2H3,(H,18,22)(H,19,24)(H,20,23) |
| InChIKey | NSNGQFCTAXHDSL-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|