C27H27ClN6O3 — CID 17072213
7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]purine-2,6-dione (PubChem CID 17072213) has the molecular formula C27H27ClN6O3 and a molecular weight of 519.01 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]purine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]purine-2,6-dione |
|---|---|
| PubChem CID | 17072213 |
| Molecular Formula | C27H27ClN6O3 |
| Molecular Weight | 519.01 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N3CCN(C(=O)/C=C/c4ccccc4)CC3)n2Cc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C27H27ClN6O3/c1-30-24-23(25(36)31(2)27(30)37)34(18-20-8-11-21(28)12-9-20)26(29-24)33-16-14-32(15-17-33)22(35)13-10-19-6-4-3-5-7-19/h3-13H,14-18H2,1-2H3/b13-10+ |
| InChIKey | YHOHYRUAEQXSEZ-JLHYYAGUSA-N |
| XLogP | 2.50 |
| TPSA | 85.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.01 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|