C24H29F3N8S — CID 170724973
4-N-[2-(dimethylamino)ethyl]-5-ethanimidoyl-2-[3-ethyl-4-[[4-(trifluoromethyl)-2-pyridinyl]sulfanylamino]phenyl]pyrimidine-4,6-diamine (PubChem CID 170724973) has the molecular formula C24H29F3N8S and a molecular weight of 518.61 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-5-ethanimidoyl-2-[3-ethyl-4-[[4-(trifluoromethyl)-2-pyridinyl]sulfanylamino]phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-5-ethanimidoyl-2-[3-ethyl-4-[[4-(trifluoromethyl)-2-pyridinyl]sulfanylamino]phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 170724973 |
| Molecular Formula | C24H29F3N8S |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-5-ethanimidoyl-2-[3-ethyl-4-[[4-(trifluoromethyl)-2-pyridinyl]sulfanylamino]phenyl]pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\C)c1c(N)nc(-c2ccc(NSc3cc(C(F)(F)F)ccn3)c(CC)c2)nc1NCCN(C)C |
| InChI | InChI=1S/C24H29F3N8S/c1-5-15-12-16(6-7-18(15)34-36-19-13-17(8-9-30-19)24(25,26)27)22-32-21(29)20(14(2)28)23(33-22)31-10-11-35(3)4/h6-9,12-13,28,34H,5,10-11H2,1-4H3,(H3,29,31,32,33)/b28-14+ |
| InChIKey | DISJBPWAXALKCA-CCVNUDIWSA-N |
| XLogP | 5.18 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|