C18H18N4O5 — CID 170727247
(4S,6S)-4-amino-13-(2,6-dioxopiperidin-3-yl)-8-oxa-2,13-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),10,15-triene-12,14-dione (PubChem CID 170727247) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is (4S,6S)-4-amino-13-(2,6-dioxopiperidin-3-yl)-8-oxa-2,13-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),10,15-triene-12,14-dione.
| Compound Name | (4S,6S)-4-amino-13-(2,6-dioxopiperidin-3-yl)-8-oxa-2,13-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),10,15-triene-12,14-dione |
|---|---|
| PubChem CID | 170727247 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (4S,6S)-4-amino-13-(2,6-dioxopiperidin-3-yl)-8-oxa-2,13-diazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),10,15-triene-12,14-dione |
| SMILES | N[C@H]1C[C@H]2COc3cc4c(cc3N2C1)C(=O)N(C1CCC(=O)NC1=O)C4=O |
| InChI | InChI=1S/C18H18N4O5/c19-8-3-9-7-27-14-5-11-10(4-13(14)21(9)6-8)17(25)22(18(11)26)12-1-2-15(23)20-16(12)24/h4-5,8-9,12H,1-3,6-7,19H2,(H,20,23,24)/t8-,9-,12?/m0/s1 |
| InChIKey | UKEZTYMPAKUOFL-VTGJNACWSA-N |
| XLogP | -0.61 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|