C29H36N4O — CID 170729886
6-cyclohexa-1,5-dien-1-yl-5-[2-(3,9-diazaspiro[5.5]undecan-3-yl)pyrimidin-5-yl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 170729886) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is 6-cyclohexa-1,5-dien-1-yl-5-[2-(3,9-diazaspiro[5.5]undecan-3-yl)pyrimidin-5-yl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 6-cyclohexa-1,5-dien-1-yl-5-[2-(3,9-diazaspiro[5.5]undecan-3-yl)pyrimidin-5-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 170729886 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 6-cyclohexa-1,5-dien-1-yl-5-[2-(3,9-diazaspiro[5.5]undecan-3-yl)pyrimidin-5-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Oc1ccc2c(c1)CCC(C1=CCCC=C1)C2c1cnc(N2CCC3(CCNCC3)CC2)nc1 |
| InChI | InChI=1S/C29H36N4O/c34-24-7-9-26-22(18-24)6-8-25(21-4-2-1-3-5-21)27(26)23-19-31-28(32-20-23)33-16-12-29(13-17-33)10-14-30-15-11-29/h2,4-5,7,9,18-20,25,27,30,34H,1,3,6,8,10-17H2 |
| InChIKey | URHNSHXJILYHOA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |