C26H35N3O2 — CID 170732207
2-(1-ethylpiperidin-4-yl)-1-[1-[5-(3-methoxyphenyl)-2-pyridinyl]piperidin-3-yl]ethanone (PubChem CID 170732207) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-4-yl)-1-[1-[5-(3-methoxyphenyl)-2-pyridinyl]piperidin-3-yl]ethanone.
| Compound Name | 2-(1-ethylpiperidin-4-yl)-1-[1-[5-(3-methoxyphenyl)-2-pyridinyl]piperidin-3-yl]ethanone |
|---|---|
| PubChem CID | 170732207 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 2-(1-ethylpiperidin-4-yl)-1-[1-[5-(3-methoxyphenyl)-2-pyridinyl]piperidin-3-yl]ethanone |
| SMILES | CCN1CCC(CC(=O)C2CCCN(c3ccc(-c4cccc(OC)c4)cn3)C2)CC1 |
| InChI | InChI=1S/C26H35N3O2/c1-3-28-14-11-20(12-15-28)16-25(30)23-7-5-13-29(19-23)26-10-9-22(18-27-26)21-6-4-8-24(17-21)31-2/h4,6,8-10,17-18,20,23H,3,5,7,11-16,19H2,1-2H3 |
| InChIKey | CVPAFLVGZLCVNW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |