C19H22N6O — CID 170734022
4-[3-[(3aS,7aR)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-5-methyl-1,2,4-triazin-6-yl]-3-hydroxybenzonitrile (PubChem CID 170734022) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 4-[3-[(3aS,7aR)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-5-methyl-1,2,4-triazin-6-yl]-3-hydroxybenzonitrile.
| Compound Name | 4-[3-[(3aS,7aR)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-5-methyl-1,2,4-triazin-6-yl]-3-hydroxybenzonitrile |
|---|---|
| PubChem CID | 170734022 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-[3-[(3aS,7aR)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-5-methyl-1,2,4-triazin-6-yl]-3-hydroxybenzonitrile |
| SMILES | Cc1nc(N2CC[C@@H]3CCN(C)C[C@@H]32)nnc1-c1ccc(C#N)cc1O |
| InChI | InChI=1S/C19H22N6O/c1-12-18(15-4-3-13(10-20)9-17(15)26)22-23-19(21-12)25-8-6-14-5-7-24(2)11-16(14)25/h3-4,9,14,16,26H,5-8,11H2,1-2H3/t14-,16-/m0/s1 |
| InChIKey | MKCHQYAKPRRAPS-HOCLYGCPSA-N |
| XLogP | 1.95 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |