C8H9F2N3 — CID 170745941
4-(aminomethyl)-2,6-difluorobenzenecarboximidamide (PubChem CID 170745941) has the molecular formula C8H9F2N3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 4-(aminomethyl)-2,6-difluorobenzenecarboximidamide.
| Compound Name | 4-(aminomethyl)-2,6-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 170745941 |
| Molecular Formula | C8H9F2N3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4-(aminomethyl)-2,6-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(F)cc(CN)cc1F |
| InChI | InChI=1S/C8H9F2N3/c9-5-1-4(3-11)2-6(10)7(5)8(12)13/h1-2H,3,11H2,(H3,12,13) |
| InChIKey | DWYDEYNPBGTIMI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|