C10H19N3O — CID 170767769
1-(1,3-dimethylpiperidin-3-yl)-3-ethenylurea (PubChem CID 170767769) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(1,3-dimethylpiperidin-3-yl)-3-ethenylurea.
| Compound Name | 1-(1,3-dimethylpiperidin-3-yl)-3-ethenylurea |
|---|---|
| PubChem CID | 170767769 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-(1,3-dimethylpiperidin-3-yl)-3-ethenylurea |
| SMILES | C=CNC(=O)NC1(C)CCCN(C)C1 |
| InChI | InChI=1S/C10H19N3O/c1-4-11-9(14)12-10(2)6-5-7-13(3)8-10/h4H,1,5-8H2,2-3H3,(H2,11,12,14) |
| InChIKey | LTYFFZPTVLLVBB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |