C15H31N3 — CID 170791131
(2Z)-4-(butylamino)-N'-methyl-N-propylpenta-2,4-dienimidamide;ethane (PubChem CID 170791131) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is (2Z)-4-(butylamino)-N'-methyl-N-propylpenta-2,4-dienimidamide;ethane.
| Compound Name | (2Z)-4-(butylamino)-N'-methyl-N-propylpenta-2,4-dienimidamide;ethane |
|---|---|
| PubChem CID | 170791131 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | (2Z)-4-(butylamino)-N'-methyl-N-propylpenta-2,4-dienimidamide;ethane |
| SMILES | C=C(/C=C\C(=N\C)NCCC)NCCCC.CC |
| InChI | InChI=1S/C13H25N3.C2H6/c1-5-7-11-15-12(3)8-9-13(14-4)16-10-6-2;1-2/h8-9,15H,3,5-7,10-11H2,1-2,4H3,(H,14,16);1-2H3/b9-8-; |
| InChIKey | IAJMTINYEYZWKU-UOQXYWCXSA-N |
| XLogP | 3.50 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|