C24H31NO4 — CID 170792834
4-[4-(4-hydroxybut-1-ynyl)phenyl]-2-methylphenol;N-methylethenamine;oxolan-3-ol (PubChem CID 170792834) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[4-(4-hydroxybut-1-ynyl)phenyl]-2-methylphenol;N-methylethenamine;oxolan-3-ol.
| Compound Name | 4-[4-(4-hydroxybut-1-ynyl)phenyl]-2-methylphenol;N-methylethenamine;oxolan-3-ol |
|---|---|
| PubChem CID | 170792834 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 4-[4-(4-hydroxybut-1-ynyl)phenyl]-2-methylphenol;N-methylethenamine;oxolan-3-ol |
| SMILES | C=CNC.Cc1cc(-c2ccc(C#CCCO)cc2)ccc1O.OC1CCOC1 |
| InChI | InChI=1S/C17H16O2.C4H8O2.C3H7N/c1-13-12-16(9-10-17(13)19)15-7-5-14(6-8-15)4-2-3-11-18;5-4-1-2-6-3-4;1-3-4-2/h5-10,12,18-19H,3,11H2,1H3;4-5H,1-3H2;3-4H,1H2,2H3 |
| InChIKey | UUBQRYLOYDXMRJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|