C17H16O8 — CID 170794714
3,5,6,7,8-pentahydroxy-2-(2-hydroxyphenyl)-2,3-dimethylchromen-4-one (PubChem CID 170794714) has the molecular formula C17H16O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is 3,5,6,7,8-pentahydroxy-2-(2-hydroxyphenyl)-2,3-dimethylchromen-4-one.
| Compound Name | 3,5,6,7,8-pentahydroxy-2-(2-hydroxyphenyl)-2,3-dimethylchromen-4-one |
|---|---|
| PubChem CID | 170794714 |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3,5,6,7,8-pentahydroxy-2-(2-hydroxyphenyl)-2,3-dimethylchromen-4-one |
| SMILES | CC1(O)C(=O)c2c(O)c(O)c(O)c(O)c2OC1(C)c1ccccc1O |
| InChI | InChI=1S/C17H16O8/c1-16(24)15(23)9-10(19)11(20)12(21)13(22)14(9)25-17(16,2)7-5-3-4-6-8(7)18/h3-6,18-22,24H,1-2H3 |
| InChIKey | HIGZMUVDBDNMJW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|