C16H19BClNO3S — CID 170801657
3-(2-chloro-1,3-benzothiazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170801657) has the molecular formula C16H19BClNO3S and a molecular weight of 351.66 g/mol. Its IUPAC name is 3-(2-chloro-1,3-benzothiazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-(2-chloro-1,3-benzothiazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170801657 |
| Molecular Formula | C16H19BClNO3S |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3-(2-chloro-1,3-benzothiazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | CC1(C)OB(C(=Cc2ccc3nc(Cl)sc3c2)CO)OC1(C)C |
| InChI | InChI=1S/C16H19BClNO3S/c1-15(2)16(3,4)22-17(21-15)11(9-20)7-10-5-6-12-13(8-10)23-14(18)19-12/h5-8,20H,9H2,1-4H3 |
| InChIKey | MYEAUAAZGZLLCC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|