C25H27BF3NO6 — CID 170813653
benzyl N-[3-[3-formyl-5-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813653) has the molecular formula C25H27BF3NO6 and a molecular weight of 505.30 g/mol. Its IUPAC name is benzyl N-[3-[3-formyl-5-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[3-formyl-5-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813653 |
| Molecular Formula | C25H27BF3NO6 |
| Molecular Weight | 505.30 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | benzyl N-[3-[3-formyl-5-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cc(C=O)cc(OC(F)(F)F)c2)CNC(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C25H27BF3NO6/c1-23(2)24(3,4)36-26(35-23)20(14-30-22(32)33-16-17-8-6-5-7-9-17)11-18-10-19(15-31)13-21(12-18)34-25(27,28)29/h5-13,15H,14,16H2,1-4H3,(H,30,32) |
| InChIKey | PVGAHWZMKUBSNA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.30 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|