C15H23BClN3O2 — CID 170815413
2-chloro-3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-4-amine (PubChem CID 170815413) has the molecular formula C15H23BClN3O2 and a molecular weight of 323.63 g/mol. Its IUPAC name is 2-chloro-3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-4-amine.
| Compound Name | 2-chloro-3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-4-amine |
|---|---|
| PubChem CID | 170815413 |
| Molecular Formula | C15H23BClN3O2 |
| Molecular Weight | 323.63 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-chloro-3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-4-amine |
| SMILES | CNCC(=Cc1c(N)ccnc1Cl)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H23BClN3O2/c1-14(2)15(3,4)22-16(21-14)10(9-19-5)8-11-12(18)6-7-20-13(11)17/h6-8,19H,9H2,1-5H3,(H2,18,20) |
| InChIKey | BEXCKKLILCERFE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.63 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|