C8H10O4S2 — CID 170819462
2-(1,2-dihydroxy-3-sulfanylpropyl)thiophene-3-carboxylic acid (PubChem CID 170819462) has the molecular formula C8H10O4S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(1,2-dihydroxy-3-sulfanylpropyl)thiophene-3-carboxylic acid.
| Compound Name | 2-(1,2-dihydroxy-3-sulfanylpropyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 170819462 |
| Molecular Formula | C8H10O4S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 2-(1,2-dihydroxy-3-sulfanylpropyl)thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1ccsc1C(O)C(O)CS |
| InChI | InChI=1S/C8H10O4S2/c9-5(3-13)6(10)7-4(8(11)12)1-2-14-7/h1-2,5-6,9-10,13H,3H2,(H,11,12) |
| InChIKey | YSSBNDDBOJLFKB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|