C9H10FNO4S — CID 170820304
2-(1,2-dihydroxy-3-sulfanylpropyl)-3-fluoropyridine-4-carboxylic acid (PubChem CID 170820304) has the molecular formula C9H10FNO4S and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(1,2-dihydroxy-3-sulfanylpropyl)-3-fluoropyridine-4-carboxylic acid.
| Compound Name | 2-(1,2-dihydroxy-3-sulfanylpropyl)-3-fluoropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 170820304 |
| Molecular Formula | C9H10FNO4S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2-(1,2-dihydroxy-3-sulfanylpropyl)-3-fluoropyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(C(O)C(O)CS)c1F |
| InChI | InChI=1S/C9H10FNO4S/c10-6-4(9(14)15)1-2-11-7(6)8(13)5(12)3-16/h1-2,5,8,12-13,16H,3H2,(H,14,15) |
| InChIKey | FZGAPQJAVQKEPK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|