C14H17NO4S — CID 170820894
ethyl 6-(1,2-dihydroxy-3-sulfanylpropyl)-1H-indole-2-carboxylate (PubChem CID 170820894) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is ethyl 6-(1,2-dihydroxy-3-sulfanylpropyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-(1,2-dihydroxy-3-sulfanylpropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 170820894 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | ethyl 6-(1,2-dihydroxy-3-sulfanylpropyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2ccc(C(O)C(O)CS)cc2[nH]1 |
| InChI | InChI=1S/C14H17NO4S/c1-2-19-14(18)11-5-8-3-4-9(6-10(8)15-11)13(17)12(16)7-20/h3-6,12-13,15-17,20H,2,7H2,1H3 |
| InChIKey | GTECULBYOGHTNN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|